About 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide
3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide (PubChem CID 153326466) has the molecular formula C15H19Cl2N3O2S
and a molecular weight of 376.31 g/mol. Its IUPAC name is 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide |
| PubChem CID | 153326466 |
| Molecular Formula | C15H19Cl2N3O2S |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide |
| SMILES | CCc1c(CN(C)S(=O)(=O)c2cc(Cl)cc(Cl)c2)c(C)nn1C |
| InChI | InChI=1S/C15H19Cl2N3O2S/c1-5-15-14(10(2)18-20(15)4)9-19(3)23(21,22)13-7-11(16)6-12(17)8-13/h6-8H,5,9H2,1-4H3 |
| InChIKey | UOXACBKJDHSUJE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide?
The IUPAC name of 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide (CID 153326466) is 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide.
What is the SMILES notation for 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide?
The canonical SMILES for 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide is CCc1c(CN(C)S(=O)(=O)c2cc(Cl)cc(Cl)c2)c(C)nn1C.
What is the InChIKey of 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide?
The InChIKey is UOXACBKJDHSUJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N3O2S/c1-5-15-14(10(2)18-20(15)4)9-19(3)23(21,22)13-7-11(16)6-12(17)8-13/h6-8H,5,9H2,1-4H3.
What are the key properties of 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide?
3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide has a molecular weight of 376.31 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[(5-ethyl-1,3-dimethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide is sourced from PubChem (CID 153326466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).