About 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide
5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide (PubChem CID 153326548) has the molecular formula C19H24N4O2S
and a molecular weight of 372.49 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide |
| PubChem CID | 153326548 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide |
| SMILES | Cc1nn(C)cc1CN(C)S(=O)(=O)c1ccc2c(N(C)C)cccc2c1 |
| InChI | InChI=1S/C19H24N4O2S/c1-14-16(12-22(4)20-14)13-23(5)26(24,25)17-9-10-18-15(11-17)7-6-8-19(18)21(2)3/h6-12H,13H2,1-5H3 |
| InChIKey | WTTXVIFFMSIRBC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide?
The IUPAC name of 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide (CID 153326548) is 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide.
What is the SMILES notation for 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide?
The canonical SMILES for 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide is Cc1nn(C)cc1CN(C)S(=O)(=O)c1ccc2c(N(C)C)cccc2c1.
What is the InChIKey of 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide?
The InChIKey is WTTXVIFFMSIRBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O2S/c1-14-16(12-22(4)20-14)13-23(5)26(24,25)17-9-10-18-15(11-17)7-6-8-19(18)21(2)3/h6-12H,13H2,1-5H3.
What are the key properties of 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide?
5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide has a molecular weight of 372.49 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-methylnaphthalene-2-sulfonamide is sourced from PubChem (CID 153326548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).