About CID 153327029
CID 153327029 (PubChem CID 153327029) has the molecular formula C21H44O3Si4
and a molecular weight of 456.92 g/mol.
Molecular Properties
| Compound Name | CID 153327029 |
| PubChem CID | 153327029 |
| Molecular Formula | C21H44O3Si4 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)(C)C(C)(C)[Si](CC)COC(=O)OC[Si](CC)C(C)(C)[Si](C)(C)C=C |
| InChI | InChI=1S/C21H44O3Si4/c1-13-25(20(5,6)27(9,10)15-3)17-23-19(22)24-18-26(14-2)21(7,8)28(11,12)16-4/h15-16H,3-4,13-14,17-18H2,1-2,5-12H3 |
| InChIKey | CXSARJQJYCQMKM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153327029 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153327029?
The IUPAC name of CID 153327029 (CID 153327029) is not available.
What is the SMILES notation for CID 153327029?
The canonical SMILES for CID 153327029 is C=C[Si](C)(C)C(C)(C)[Si](CC)COC(=O)OC[Si](CC)C(C)(C)[Si](C)(C)C=C.
What is the InChIKey of CID 153327029?
The InChIKey is CXSARJQJYCQMKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O3Si4/c1-13-25(20(5,6)27(9,10)15-3)17-23-19(22)24-18-26(14-2)21(7,8)28(11,12)16-4/h15-16H,3-4,13-14,17-18H2,1-2,5-12H3.
What are the key properties of CID 153327029?
CID 153327029 has a molecular weight of 456.92 g/mol, XLogP of 6.75, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153327029 is sourced from PubChem (CID 153327029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).