C19H23FN2O2 — CID 153327338
(2S)-2-amino-N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pentanamide (PubChem CID 153327338) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pentanamide.
| Compound Name | (2S)-2-amino-N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 153327338 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2S)-2-amino-N-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pentanamide |
| SMILES | CCC[C@H](N)C(=O)NCc1ccc(OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H23FN2O2/c1-2-4-18(21)19(23)22-12-14-7-9-17(10-8-14)24-13-15-5-3-6-16(20)11-15/h3,5-11,18H,2,4,12-13,21H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | GNUQWAOLOHYQGQ-SFHVURJKSA-N |
| XLogP | 3.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |