About 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile
1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile (PubChem CID 15332744) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile |
| PubChem CID | 15332744 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)C1 |
| InChI | InChI=1S/C8H8N2O2/c1-5-3-7(11)10(2)8(12)6(5)4-9/h3H2,1-2H3 |
| InChIKey | IDZOJEUXQIGYHV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile?
The IUPAC name of 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile (CID 15332744) is 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile.
What is the SMILES notation for 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile?
The canonical SMILES for 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile is CC1=C(C#N)C(=O)N(C)C(=O)C1.
What is the InChIKey of 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile?
The InChIKey is IDZOJEUXQIGYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-5-3-7(11)10(2)8(12)6(5)4-9/h3H2,1-2H3.
What are the key properties of 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile?
1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile has a molecular weight of 164.16 g/mol, XLogP of 0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,6-dioxo-3H-pyridine-5-carbonitrile is sourced from PubChem (CID 15332744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).