C26H27ClN6O2 — CID 153327820
[1-[4-[2-(2-amino-3-pyridinyl)-5-chloroimidazo[4,5-b]pyridin-3-yl]phenyl]-2-tert-butylcyclobutyl] carbamate (PubChem CID 153327820) has the molecular formula C26H27ClN6O2 and a molecular weight of 491.00 g/mol. Its IUPAC name is [1-[4-[2-(2-amino-3-pyridinyl)-5-chloroimidazo[4,5-b]pyridin-3-yl]phenyl]-2-tert-butylcyclobutyl] carbamate.
| Compound Name | [1-[4-[2-(2-amino-3-pyridinyl)-5-chloroimidazo[4,5-b]pyridin-3-yl]phenyl]-2-tert-butylcyclobutyl] carbamate |
|---|---|
| PubChem CID | 153327820 |
| Molecular Formula | C26H27ClN6O2 |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | [1-[4-[2-(2-amino-3-pyridinyl)-5-chloroimidazo[4,5-b]pyridin-3-yl]phenyl]-2-tert-butylcyclobutyl] carbamate |
| SMILES | CC(C)(C)C1CCC1(OC(N)=O)c1ccc(-n2c(-c3cccnc3N)nc3ccc(Cl)nc32)cc1 |
| InChI | InChI=1S/C26H27ClN6O2/c1-25(2,3)19-12-13-26(19,35-24(29)34)15-6-8-16(9-7-15)33-22(17-5-4-14-30-21(17)28)31-18-10-11-20(27)32-23(18)33/h4-11,14,19H,12-13H2,1-3H3,(H2,28,30)(H2,29,34) |
| InChIKey | UXNOIXAJTJINLA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|