About 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one
2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 153328051) has the molecular formula C6H4FN3O
and a molecular weight of 153.12 g/mol. Its IUPAC name is 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 153328051 |
| Molecular Formula | C6H4FN3O |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(F)nc2[nH]ccc12 |
| InChI | InChI=1S/C6H4FN3O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H2,8,9,10,11) |
| InChIKey | JHOAVFSYZAHUKA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (CID 153328051) is 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is O=c1[nH]c(F)nc2[nH]ccc12.
What is the InChIKey of 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is JHOAVFSYZAHUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FN3O/c7-6-9-4-3(1-2-8-4)5(11)10-6/h1-2H,(H2,8,9,10,11).
What are the key properties of 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 153.12 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 153328051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).