C11H15F3NOY- — CID 153329504
(4,4-difluorocyclohexyl)-(3-fluoropyrrolidin-4-id-1-yl)methanone;yttrium (PubChem CID 153329504) has the molecular formula C11H15F3NOY- and a molecular weight of 323.15 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(3-fluoropyrrolidin-4-id-1-yl)methanone;yttrium.
| Compound Name | (4,4-difluorocyclohexyl)-(3-fluoropyrrolidin-4-id-1-yl)methanone;yttrium |
|---|---|
| PubChem CID | 153329504 |
| Molecular Formula | C11H15F3NOY- |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(3-fluoropyrrolidin-4-id-1-yl)methanone;yttrium |
| SMILES | O=C(C1CCC(F)(F)CC1)N1C[CH-]C(F)C1.[Y] |
| InChI | InChI=1S/C11H15F3NO.Y/c12-9-3-6-15(7-9)10(16)8-1-4-11(13,14)5-2-8;/h3,8-9H,1-2,4-7H2;/q-1; |
| InChIKey | KQNLLZBOHKZQIF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|