C9H16F2O — CID 153329639
1-(2-ethylcyclopentyl)-2,2-difluoroethanol (PubChem CID 153329639) has the molecular formula C9H16F2O and a molecular weight of 178.22 g/mol. Its IUPAC name is 1-(2-ethylcyclopentyl)-2,2-difluoroethanol.
| Compound Name | 1-(2-ethylcyclopentyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 153329639 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-(2-ethylcyclopentyl)-2,2-difluoroethanol |
| SMILES | CCC1CCCC1C(O)C(F)F |
| InChI | InChI=1S/C9H16F2O/c1-2-6-4-3-5-7(6)8(12)9(10)11/h6-9,12H,2-5H2,1H3 |
| InChIKey | IDXFDVRQWOTQKB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |