About N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide
N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide (PubChem CID 15332974) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide |
| PubChem CID | 15332974 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCOCCOC |
| InChI | InChI=1S/C10H19NO3/c1-9(2)10(12)11(3)5-6-14-8-7-13-4/h1,5-8H2,2-4H3 |
| InChIKey | XBDLJNXYZLJNAV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide?
The IUPAC name of N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide (CID 15332974) is N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide.
What is the SMILES notation for N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide?
The canonical SMILES for N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide is C=C(C)C(=O)N(C)CCOCCOC.
What is the InChIKey of N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide?
The InChIKey is XBDLJNXYZLJNAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-9(2)10(12)11(3)5-6-14-8-7-13-4/h1,5-8H2,2-4H3.
What are the key properties of N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide?
N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide has a molecular weight of 201.27 g/mol, XLogP of 0.68, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-methoxyethoxy)ethyl]-N,2-dimethylprop-2-enamide is sourced from PubChem (CID 15332974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).