About 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine
1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine (PubChem CID 153329743) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine |
| PubChem CID | 153329743 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine |
| SMILES | COC1C=CC(N2CCCC2)=CC1 |
| InChI | InChI=1S/C11H17NO/c1-13-11-6-4-10(5-7-11)12-8-2-3-9-12/h4-6,11H,2-3,7-9H2,1H3 |
| InChIKey | NKXCJPBXGLYQSM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine (CID 153329743) is 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine is COC1C=CC(N2CCCC2)=CC1.
What is the InChIKey of 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine?
The InChIKey is NKXCJPBXGLYQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-13-11-6-4-10(5-7-11)12-8-2-3-9-12/h4-6,11H,2-3,7-9H2,1H3.
What are the key properties of 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine?
1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine has a molecular weight of 179.26 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxycyclohexa-1,5-dien-1-yl)pyrrolidine is sourced from PubChem (CID 153329743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).