C34H51P — CID 153329750
[2,6-ditert-butyl-4-[cyclobuten-1-yl-(3,5-ditert-butyl-4-methylphenyl)methyl]phenyl]phosphane (PubChem CID 153329750) has the molecular formula C34H51P and a molecular weight of 490.76 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[cyclobuten-1-yl-(3,5-ditert-butyl-4-methylphenyl)methyl]phenyl]phosphane.
| Compound Name | [2,6-ditert-butyl-4-[cyclobuten-1-yl-(3,5-ditert-butyl-4-methylphenyl)methyl]phenyl]phosphane |
|---|---|
| PubChem CID | 153329750 |
| Molecular Formula | C34H51P |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | [2,6-ditert-butyl-4-[cyclobuten-1-yl-(3,5-ditert-butyl-4-methylphenyl)methyl]phenyl]phosphane |
| SMILES | Cc1c(C(C)(C)C)cc(C(C2=CCC2)c2cc(C(C)(C)C)c(P)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C34H51P/c1-21-25(31(2,3)4)17-23(18-26(21)32(5,6)7)29(22-15-14-16-22)24-19-27(33(8,9)10)30(35)28(20-24)34(11,12)13/h15,17-20,29H,14,16,35H2,1-13H3 |
| InChIKey | IVLZXLFIGCPJBD-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|