C14H25NO — CID 153330092
N-methyl-2-[(3Z,5Z,7Z)-6-methylnona-3,5,7-trien-4-yl]oxypropan-1-amine (PubChem CID 153330092) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-methyl-2-[(3Z,5Z,7Z)-6-methylnona-3,5,7-trien-4-yl]oxypropan-1-amine.
| Compound Name | N-methyl-2-[(3Z,5Z,7Z)-6-methylnona-3,5,7-trien-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 153330092 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-methyl-2-[(3Z,5Z,7Z)-6-methylnona-3,5,7-trien-4-yl]oxypropan-1-amine |
| SMILES | C/C=C\C(C)=C/C(=C/CC)OC(C)CNC |
| InChI | InChI=1S/C14H25NO/c1-6-8-12(3)10-14(9-7-2)16-13(4)11-15-5/h6,8-10,13,15H,7,11H2,1-5H3/b8-6-,12-10-,14-9- |
| InChIKey | UAVFTXUWFJXOSA-DGHFLRIRSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|