C15H33N — CID 153330187
ethane;6-ethyl-6-propyl-1,2,3,7-tetrahydroazepine (PubChem CID 153330187) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is ethane;6-ethyl-6-propyl-1,2,3,7-tetrahydroazepine.
| Compound Name | ethane;6-ethyl-6-propyl-1,2,3,7-tetrahydroazepine |
|---|---|
| PubChem CID | 153330187 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | ethane;6-ethyl-6-propyl-1,2,3,7-tetrahydroazepine |
| SMILES | CC.CC.CCCC1(CC)C=CCCNC1 |
| InChI | InChI=1S/C11H21N.2C2H6/c1-3-7-11(4-2)8-5-6-9-12-10-11;2*1-2/h5,8,12H,3-4,6-7,9-10H2,1-2H3;2*1-2H3 |
| InChIKey | BMZOSMVVXGAIBP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|