About 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol
3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol (PubChem CID 153330254) has the molecular formula C17H20F2N2O3
and a molecular weight of 338.35 g/mol. Its IUPAC name is 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol |
| PubChem CID | 153330254 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol |
| SMILES | OC1CC(OC2CCN(c3ccnc(C#CC(O)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C17H20F2N2O3/c18-17(19,23)5-1-12-9-13(2-6-20-12)21-7-3-15(4-8-21)24-16-10-14(22)11-16/h2,6,9,14-16,22-23H,3-4,7-8,10-11H2 |
| InChIKey | MSXVROWUXZPAAM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol?
The IUPAC name of 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol (CID 153330254) is 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol.
What is the SMILES notation for 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol?
The canonical SMILES for 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol is OC1CC(OC2CCN(c3ccnc(C#CC(O)(F)F)c3)CC2)C1.
What is the InChIKey of 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol?
The InChIKey is MSXVROWUXZPAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N2O3/c18-17(19,23)5-1-12-9-13(2-6-20-12)21-7-3-15(4-8-21)24-16-10-14(22)11-16/h2,6,9,14-16,22-23H,3-4,7-8,10-11H2.
What are the key properties of 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol?
3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol has a molecular weight of 338.35 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[2-(3,3-difluoro-3-hydroxyprop-1-ynyl)-4-pyridinyl]piperidin-4-yl]oxycyclobutan-1-ol is sourced from PubChem (CID 153330254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).