About 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione
5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione (PubChem CID 153330303) has the molecular formula C23H23NO3
and a molecular weight of 361.44 g/mol. Its IUPAC name is 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione.
Molecular Properties
| Compound Name | 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione |
| PubChem CID | 153330303 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione |
| SMILES | C=C1c2ccccc2C(=O)N1C(CCC(C)=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H23NO3/c1-16(25)12-14-21(22(26)15-13-18-8-4-3-5-9-18)24-17(2)19-10-6-7-11-20(19)23(24)27/h3-11,21H,2,12-15H2,1H3 |
| InChIKey | XVIATLXMDNMQHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione?
The IUPAC name of 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione (CID 153330303) is 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione.
What is the SMILES notation for 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione?
The canonical SMILES for 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione is C=C1c2ccccc2C(=O)N1C(CCC(C)=O)C(=O)CCc1ccccc1.
What is the InChIKey of 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione?
The InChIKey is XVIATLXMDNMQHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO3/c1-16(25)12-14-21(22(26)15-13-18-8-4-3-5-9-18)24-17(2)19-10-6-7-11-20(19)23(24)27/h3-11,21H,2,12-15H2,1H3.
What are the key properties of 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione?
5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione has a molecular weight of 361.44 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methylidene-3-oxoisoindol-2-yl)-8-phenyloctane-2,6-dione is sourced from PubChem (CID 153330303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).