C21H33NO3 — CID 153330323
ethane;(3E,5Z)-3-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-one;3-methylpiperidine-2,6-dione (PubChem CID 153330323) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is ethane;(3E,5Z)-3-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-one;3-methylpiperidine-2,6-dione.
| Compound Name | ethane;(3E,5Z)-3-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-one;3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 153330323 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | ethane;(3E,5Z)-3-[(3Z)-2-methylpenta-1,3-dien-3-yl]hepta-3,5-dien-2-one;3-methylpiperidine-2,6-dione |
| SMILES | C=C(C)C(=C/C)/C(=C\C=C/C)C(C)=O.CC.CC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H18O.C6H9NO2.C2H6/c1-6-8-9-13(11(5)14)12(7-2)10(3)4;1-4-2-3-5(8)7-6(4)9;1-2/h6-9H,3H2,1-2,4-5H3;4H,2-3H2,1H3,(H,7,8,9);1-2H3/b8-6-,12-7-,13-9-;; |
| InChIKey | IBEHTCYWNIXPNN-FKRSCSTMSA-N |
| XLogP | 4.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|