C16H21N3O4 — CID 153330332
1-(2,6-dioxopiperidin-3-yl)-4-methylidene-3-[(Z)-prop-1-enyl]iminopiperidine-2,6-dione;ethane (PubChem CID 153330332) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-(2,6-dioxopiperidin-3-yl)-4-methylidene-3-[(Z)-prop-1-enyl]iminopiperidine-2,6-dione;ethane.
| Compound Name | 1-(2,6-dioxopiperidin-3-yl)-4-methylidene-3-[(Z)-prop-1-enyl]iminopiperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 153330332 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(2,6-dioxopiperidin-3-yl)-4-methylidene-3-[(Z)-prop-1-enyl]iminopiperidine-2,6-dione;ethane |
| SMILES | C=C1CC(=O)N(C2CCC(=O)NC2=O)C(=O)/C1=N/C=C\C.CC |
| InChI | InChI=1S/C14H15N3O4.C2H6/c1-3-6-15-12-8(2)7-11(19)17(14(12)21)9-4-5-10(18)16-13(9)20;1-2/h3,6,9H,2,4-5,7H2,1H3,(H,16,18,20);1-2H3/b6-3-,15-12+; |
| InChIKey | UNBBJJJNSYMOJP-UIKSSKRYSA-N |
| XLogP | 1.11 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|