About ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one
ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one (PubChem CID 153330466) has the molecular formula C22H43NO2
and a molecular weight of 353.59 g/mol. Its IUPAC name is ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one.
Molecular Properties
| Compound Name | ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one |
| PubChem CID | 153330466 |
| Molecular Formula | C22H43NO2 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one |
| SMILES | C=C(/C=C(\C=C/C)CCC(C)=O)OC1CC(NC)C1.CC.CC.CC |
| InChI | InChI=1S/C16H25NO2.3C2H6/c1-5-6-14(8-7-12(2)18)9-13(3)19-16-10-15(11-16)17-4;3*1-2/h5-6,9,15-17H,3,7-8,10-11H2,1-2,4H3;3*1-2H3/b6-5-,14-9+;;; |
| InChIKey | ZFNVPUOIVCRUOU-JCKXRUQUSA-N |
| XLogP | 6.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one?
The IUPAC name of ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one (CID 153330466) is ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one.
What is the SMILES notation for ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one?
The canonical SMILES for ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one is C=C(/C=C(\C=C/C)CCC(C)=O)OC1CC(NC)C1.CC.CC.CC.
What is the InChIKey of ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one?
The InChIKey is ZFNVPUOIVCRUOU-JCKXRUQUSA-N. The full InChI is InChI=1S/C16H25NO2.3C2H6/c1-5-6-14(8-7-12(2)18)9-13(3)19-16-10-15(11-16)17-4;3*1-2/h5-6,9,15-17H,3,7-8,10-11H2,1-2,4H3;3*1-2H3/b6-5-,14-9+;;;.
What are the key properties of ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one?
ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one has a molecular weight of 353.59 g/mol, XLogP of 6.22, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5Z)-7-[3-(methylamino)cyclobutyl]oxy-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-one is sourced from PubChem (CID 153330466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).