C10H19LrN2- — CID 153330751
3,7-dimethyl-1,2,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-3-ide;lawrencium (PubChem CID 153330751) has the molecular formula C10H19LrN2- and a molecular weight of 429.28 g/mol. Its IUPAC name is 3,7-dimethyl-1,2,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-3-ide;lawrencium.
| Compound Name | 3,7-dimethyl-1,2,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-3-ide;lawrencium |
|---|---|
| PubChem CID | 153330751 |
| Molecular Formula | C10H19LrN2- |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 3,7-dimethyl-1,2,4,4a,5,6,8,8a-octahydro-1,7-naphthyridin-3-ide;lawrencium |
| SMILES | C[C-]1CNC2CN(C)CCC2C1.[Lr] |
| InChI | InChI=1S/C10H19N2.Lr/c1-8-5-9-3-4-12(2)7-10(9)11-6-8;/h9-11H,3-7H2,1-2H3;/q-1; |
| InChIKey | TXWNMMBSDBSUCM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|