C18H22N6O — CID 153331068
1-[4-[4-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 153331068) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-[4-[4-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 153331068 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-[4-[4-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]-2-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | [H]/N=C(C)/C=C\c1ncc(-c2ccnc(N3CCN(C(C)=O)CC3)c2)[nH]1 |
| InChI | InChI=1S/C18H22N6O/c1-13(19)3-4-17-21-12-16(22-17)15-5-6-20-18(11-15)24-9-7-23(8-10-24)14(2)25/h3-6,11-12,19H,7-10H2,1-2H3,(H,21,22)/b4-3-,19-13+ |
| InChIKey | HEBZJSXXMLSAKC-MBVPVLJXSA-N |
| XLogP | 2.19 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|