C16H19F2N7S — CID 153331154
6-(difluoromethyl)-3-(4-piperidin-1-ylpyrimidin-2-yl)imidazo[1,2-a]pyrazine;thiohydroxylamine (PubChem CID 153331154) has the molecular formula C16H19F2N7S and a molecular weight of 379.44 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-(4-piperidin-1-ylpyrimidin-2-yl)imidazo[1,2-a]pyrazine;thiohydroxylamine.
| Compound Name | 6-(difluoromethyl)-3-(4-piperidin-1-ylpyrimidin-2-yl)imidazo[1,2-a]pyrazine;thiohydroxylamine |
|---|---|
| PubChem CID | 153331154 |
| Molecular Formula | C16H19F2N7S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-(difluoromethyl)-3-(4-piperidin-1-ylpyrimidin-2-yl)imidazo[1,2-a]pyrazine;thiohydroxylamine |
| SMILES | FC(F)c1cn2c(-c3nccc(N4CCCCC4)n3)cnc2cn1.NS |
| InChI | InChI=1S/C16H16F2N6.H3NS/c17-15(18)11-10-24-12(8-21-14(24)9-20-11)16-19-5-4-13(22-16)23-6-2-1-3-7-23;1-2/h4-5,8-10,15H,1-3,6-7H2;2H,1H2 |
| InChIKey | LTOCURVGCJZGBS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|