C20H27F2N7S — CID 153331296
6-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-N-methyl-4-[3-[(methylsulfanylamino)methyl]piperidin-1-yl]pyridin-2-amine (PubChem CID 153331296) has the molecular formula C20H27F2N7S and a molecular weight of 435.55 g/mol. Its IUPAC name is 6-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-N-methyl-4-[3-[(methylsulfanylamino)methyl]piperidin-1-yl]pyridin-2-amine.
| Compound Name | 6-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-N-methyl-4-[3-[(methylsulfanylamino)methyl]piperidin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 153331296 |
| Molecular Formula | C20H27F2N7S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 6-[2-[(Z)-4,4-difluoro-3-iminobut-1-enyl]-1H-imidazol-5-yl]-N-methyl-4-[3-[(methylsulfanylamino)methyl]piperidin-1-yl]pyridin-2-amine |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2cc(N3CCCC(CNSC)C3)cc(NC)n2)[nH]1)C(F)F |
| InChI | InChI=1S/C20H27F2N7S/c1-24-19-9-14(29-7-3-4-13(12-29)10-26-30-2)8-16(27-19)17-11-25-18(28-17)6-5-15(23)20(21)22/h5-6,8-9,11,13,20,23,26H,3-4,7,10,12H2,1-2H3,(H,24,27)(H,25,28)/b6-5-,23-15- |
| InChIKey | NEIBVRTWQCNYKS-WXPRDHTMSA-N |
| XLogP | 3.90 |
| TPSA | 92.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|