C14H25N5 — CID 153331306
(Z)-2-[6,6-dimethyl-4-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-2-yl]-3-iminoprop-1-en-1-amine (PubChem CID 153331306) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is (Z)-2-[6,6-dimethyl-4-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-2-yl]-3-iminoprop-1-en-1-amine.
| Compound Name | (Z)-2-[6,6-dimethyl-4-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-2-yl]-3-iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 153331306 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | (Z)-2-[6,6-dimethyl-4-[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]piperazin-2-yl]-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)C1CN(C(/C=C\C)=N/C)CC(C)(C)N1 |
| InChI | InChI=1S/C14H25N5/c1-5-6-13(17-4)19-9-12(11(7-15)8-16)18-14(2,3)10-19/h5-8,12,15,18H,9-10,16H2,1-4H3/b6-5-,11-8+,15-7+,17-13+ |
| InChIKey | ZSRLUAPOSFHQIG-PCAGXOTRSA-N |
| XLogP | 1.14 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|