C23H29ClN6O2 — CID 153331546
(2S)-4-[2-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]-2-methylmorpholine;(Z)-N-ethenoxy-3-methylbutan-2-imine (PubChem CID 153331546) has the molecular formula C23H29ClN6O2 and a molecular weight of 456.98 g/mol. Its IUPAC name is (2S)-4-[2-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]-2-methylmorpholine;(Z)-N-ethenoxy-3-methylbutan-2-imine.
| Compound Name | (2S)-4-[2-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]-2-methylmorpholine;(Z)-N-ethenoxy-3-methylbutan-2-imine |
|---|---|
| PubChem CID | 153331546 |
| Molecular Formula | C23H29ClN6O2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (2S)-4-[2-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]-2-methylmorpholine;(Z)-N-ethenoxy-3-methylbutan-2-imine |
| SMILES | C=CO/N=C(/C)C(C)C.C[C@H]1CN(c2ccnc(-c3cnc4ccc(Cl)cn34)n2)CCO1 |
| InChI | InChI=1S/C16H16ClN5O.C7H13NO/c1-11-9-21(6-7-23-11)15-4-5-18-16(20-15)13-8-19-14-3-2-12(17)10-22(13)14;1-5-9-8-7(4)6(2)3/h2-5,8,10-11H,6-7,9H2,1H3;5-6H,1H2,2-4H3/b;8-7-/t11-;/m0./s1 |
| InChIKey | FUVWKYWCUKFTOE-WGLXSPQZSA-N |
| XLogP | 4.85 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|