C28H24N4O4 — CID 153331831
5-formyl-N-[3-[3-[[(5-formyl-2-pyridinyl)-hydroxymethyl]amino]-2-methylphenyl]-2-methylphenyl]pyridine-2-carboxamide (PubChem CID 153331831) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is 5-formyl-N-[3-[3-[[(5-formyl-2-pyridinyl)-hydroxymethyl]amino]-2-methylphenyl]-2-methylphenyl]pyridine-2-carboxamide.
| Compound Name | 5-formyl-N-[3-[3-[[(5-formyl-2-pyridinyl)-hydroxymethyl]amino]-2-methylphenyl]-2-methylphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 153331831 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 5-formyl-N-[3-[3-[[(5-formyl-2-pyridinyl)-hydroxymethyl]amino]-2-methylphenyl]-2-methylphenyl]pyridine-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc(C=O)cn2)cccc1-c1cccc(NC(O)c2ccc(C=O)cn2)c1C |
| InChI | InChI=1S/C28H24N4O4/c1-17-21(5-3-7-23(17)31-27(35)25-11-9-19(15-33)13-29-25)22-6-4-8-24(18(22)2)32-28(36)26-12-10-20(16-34)14-30-26/h3-16,27,31,35H,1-2H3,(H,32,36) |
| InChIKey | FZTXKXVSGZXDRZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|