About 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde
4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde (PubChem CID 153331915) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde |
| PubChem CID | 153331915 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc(C2CC2)c(CNC(CO)CO)cn1 |
| InChI | InChI=1S/C13H18N2O3/c16-6-11-3-13(9-1-2-9)10(4-14-11)5-15-12(7-17)8-18/h3-4,6,9,12,15,17-18H,1-2,5,7-8H2 |
| InChIKey | FJJNTAAVHRNOTH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde?
The IUPAC name of 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde (CID 153331915) is 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde.
What is the SMILES notation for 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde?
The canonical SMILES for 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde is O=Cc1cc(C2CC2)c(CNC(CO)CO)cn1.
What is the InChIKey of 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde?
The InChIKey is FJJNTAAVHRNOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c16-6-11-3-13(9-1-2-9)10(4-14-11)5-15-12(7-17)8-18/h3-4,6,9,12,15,17-18H,1-2,5,7-8H2.
What are the key properties of 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde?
4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde has a molecular weight of 250.30 g/mol, XLogP of 0.21, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5-[(1,3-dihydroxypropan-2-ylamino)methyl]pyridine-2-carbaldehyde is sourced from PubChem (CID 153331915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).