C13H16BN3O3 — CID 153332175
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-5-carbaldehyde (PubChem CID 153332175) has the molecular formula C13H16BN3O3 and a molecular weight of 273.10 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-5-carbaldehyde.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 153332175 |
| Molecular Formula | C13H16BN3O3 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidine-5-carbaldehyde |
| SMILES | CC1(C)OB(c2cc3nc(C=O)ccn3n2)OC1(C)C |
| InChI | InChI=1S/C13H16BN3O3/c1-12(2)13(3,4)20-14(19-12)10-7-11-15-9(8-18)5-6-17(11)16-10/h5-8H,1-4H3 |
| InChIKey | IQHBTABKOOEOKN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|