C15H26BNO5S2 — CID 153332206
N-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetamide;ethane;methanethiol (PubChem CID 153332206) has the molecular formula C15H26BNO5S2 and a molecular weight of 375.32 g/mol. Its IUPAC name is N-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetamide;ethane;methanethiol.
| Compound Name | N-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetamide;ethane;methanethiol |
|---|---|
| PubChem CID | 153332206 |
| Molecular Formula | C15H26BNO5S2 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylacetamide;ethane;methanethiol |
| SMILES | CC.CC(=O)NS(=O)(=O)c1ccc(B2OCC(C)(C)O2)cc1.CS |
| InChI | InChI=1S/C12H16BNO5S.C2H6.CH4S/c1-9(15)14-20(16,17)11-6-4-10(5-7-11)13-18-8-12(2,3)19-13;2*1-2/h4-7H,8H2,1-3H3,(H,14,15);1-2H3;2H,1H3 |
| InChIKey | AAVXLVUZNOEEKL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|