C27H33BF2N4O5S — CID 153332236
N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]propane-1-sulfinamide (PubChem CID 153332236) has the molecular formula C27H33BF2N4O5S and a molecular weight of 574.46 g/mol. Its IUPAC name is N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]propane-1-sulfinamide.
| Compound Name | N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]propane-1-sulfinamide |
|---|---|
| PubChem CID | 153332236 |
| Molecular Formula | C27H33BF2N4O5S |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | N-[2,6-difluoro-3-[1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine-3-carbonyl]phenyl]propane-1-sulfinamide |
| SMILES | CCCS(=O)Nc1c(F)ccc(C(=O)c2nn(C3CCCCO3)c3ncc(B4OC(C)(C)C(C)(C)O4)cc23)c1F |
| InChI | InChI=1S/C27H33BF2N4O5S/c1-6-13-40(36)33-23-19(29)11-10-17(21(23)30)24(35)22-18-14-16(28-38-26(2,3)27(4,5)39-28)15-31-25(18)34(32-22)20-9-7-8-12-37-20/h10-11,14-15,20,33H,6-9,12-13H2,1-5H3 |
| InChIKey | AGCDWDGZJSQCII-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|