About (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane
(E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane (PubChem CID 153332321) has the molecular formula C14H23F3O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane.
Molecular Properties
| Compound Name | (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane |
| PubChem CID | 153332321 |
| Molecular Formula | C14H23F3O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane |
| SMILES | C=COCCCC.CCCCO/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2.C6H12O/c1-2-3-5-13-6-4-7(12)8(9,10)11;1-3-5-6-7-4-2/h4,6H,2-3,5H2,1H3;4H,2-3,5-6H2,1H3/b6-4+; |
| InChIKey | LGXRKVCMDWUILA-CVDVRWGVSA-N |
| XLogP | 4.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane?
The IUPAC name of (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane (CID 153332321) is (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane.
What is the SMILES notation for (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane?
The canonical SMILES for (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane is C=COCCCC.CCCCO/C=C/C(=O)C(F)(F)F.
What is the InChIKey of (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane?
The InChIKey is LGXRKVCMDWUILA-CVDVRWGVSA-N. The full InChI is InChI=1S/C8H11F3O2.C6H12O/c1-2-3-5-13-6-4-7(12)8(9,10)11;1-3-5-6-7-4-2/h4,6H,2-3,5H2,1H3;4H,2-3,5-6H2,1H3/b6-4+;.
What are the key properties of (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane?
(E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane has a molecular weight of 296.33 g/mol, XLogP of 4.39, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-butoxy-1,1,1-trifluorobut-3-en-2-one;1-ethenoxybutane is sourced from PubChem (CID 153332321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).