C13H2ClN7S2 — CID 153332683
2-[(6-chloropyridazin-3-yl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile (PubChem CID 153332683) has the molecular formula C13H2ClN7S2 and a molecular weight of 355.80 g/mol. Its IUPAC name is 2-[(6-chloropyridazin-3-yl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile.
| Compound Name | 2-[(6-chloropyridazin-3-yl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 153332683 |
| Molecular Formula | C13H2ClN7S2 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 2-[(6-chloropyridazin-3-yl)-cyanomethylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
| SMILES | N#CC(=C1Sc2nc(C#N)c(C#N)nc2S1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C13H2ClN7S2/c14-10-2-1-7(20-21-10)6(3-15)13-22-11-12(23-13)19-9(5-17)8(4-16)18-11/h1-2H |
| InChIKey | IYUCKKHNEDZJRP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 122.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|