C16H7N5O2S3 — CID 153332735
2-[cyano-(4-methylsulfonylphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile (PubChem CID 153332735) has the molecular formula C16H7N5O2S3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[cyano-(4-methylsulfonylphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile.
| Compound Name | 2-[cyano-(4-methylsulfonylphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 153332735 |
| Molecular Formula | C16H7N5O2S3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 2-[cyano-(4-methylsulfonylphenyl)methylidene]-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
| SMILES | CS(=O)(=O)c1ccc(C(C#N)=C2Sc3nc(C#N)c(C#N)nc3S2)cc1 |
| InChI | InChI=1S/C16H7N5O2S3/c1-26(22,23)10-4-2-9(3-5-10)11(6-17)16-24-14-15(25-16)21-13(8-19)12(7-18)20-14/h2-5H,1H3 |
| InChIKey | ZITYKZZJNFDSGW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 131.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|