C14H7F3N4O3S — CID 15333316
2-amino-4-(2,5-dicyano-3,4,6-trifluoroanilino)benzenesulfonic acid (PubChem CID 15333316) has the molecular formula C14H7F3N4O3S and a molecular weight of 368.30 g/mol. Its IUPAC name is 2-amino-4-(2,5-dicyano-3,4,6-trifluoroanilino)benzenesulfonic acid.
| Compound Name | 2-amino-4-(2,5-dicyano-3,4,6-trifluoroanilino)benzenesulfonic acid |
|---|---|
| PubChem CID | 15333316 |
| Molecular Formula | C14H7F3N4O3S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-amino-4-(2,5-dicyano-3,4,6-trifluoroanilino)benzenesulfonic acid |
| SMILES | N#Cc1c(F)c(F)c(C#N)c(Nc2ccc(S(=O)(=O)O)c(N)c2)c1F |
| InChI | InChI=1S/C14H7F3N4O3S/c15-11-7(4-18)13(17)14(8(5-19)12(11)16)21-6-1-2-10(9(20)3-6)25(22,23)24/h1-3,21H,20H2,(H,22,23,24) |
| InChIKey | JNDBSOLPOSHNHG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|