C10H18N12 — CID 15333320
2-N-[2-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]ethyl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 15333320) has the molecular formula C10H18N12 and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-N-[2-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]ethyl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]ethyl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 15333320 |
| Molecular Formula | C10H18N12 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-N-[2-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]ethyl]-2-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(CCN(C)c1nc(N)nc(N)n1)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C10H18N12/c1-21(9-17-5(11)15-6(12)18-9)3-4-22(2)10-19-7(13)16-8(14)20-10/h3-4H2,1-2H3,(H4,11,12,15,17,18)(H4,13,14,16,19,20) |
| InChIKey | KJLKORJWJYQMFD-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 187.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |