About [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate
[(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate (PubChem CID 153333202) has the molecular formula C30H36O3S2Si
and a molecular weight of 536.84 g/mol. Its IUPAC name is [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate |
| PubChem CID | 153333202 |
| Molecular Formula | C30H36O3S2Si |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1SC(SCc2ccccc2)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H36O3S2Si/c1-23(31)32-21-28-27(20-29(35-28)34-22-24-14-8-5-9-15-24)33-36(30(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,27-29H,20-22H2,1-4H3/t27-,28+,29?/m0/s1 |
| InChIKey | VGDCKLPVJPVXSI-POZJPKTBSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate?
The IUPAC name of [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate (CID 153333202) is [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate.
What is the SMILES notation for [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate?
The canonical SMILES for [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate is CC(=O)OC[C@H]1SC(SCc2ccccc2)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate?
The InChIKey is VGDCKLPVJPVXSI-POZJPKTBSA-N. The full InChI is InChI=1S/C30H36O3S2Si/c1-23(31)32-21-28-27(20-29(35-28)34-22-24-14-8-5-9-15-24)33-36(30(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,27-29H,20-22H2,1-4H3/t27-,28+,29?/m0/s1.
What are the key properties of [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate?
[(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate has a molecular weight of 536.84 g/mol, XLogP of 6.26, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-5-benzylsulfanyl-3-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]methyl acetate is sourced from PubChem (CID 153333202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).