C23H39FO3S2Si2 — CID 153333206
6-(4-fluorophenyl)sulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 153333206) has the molecular formula C23H39FO3S2Si2 and a molecular weight of 502.87 g/mol. Its IUPAC name is 6-(4-fluorophenyl)sulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | 6-(4-fluorophenyl)sulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 153333206 |
| Molecular Formula | C23H39FO3S2Si2 |
| Molecular Weight | 502.87 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 6-(4-fluorophenyl)sulfanyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CC(C)[Si]1(C(C)C)OC2CCSC2C(Sc2ccc(F)cc2)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C23H39FO3S2Si2/c1-15(2)30(16(3)4)25-21-13-14-28-22(21)23(29-20-11-9-19(24)10-12-20)26-31(27-30,17(5)6)18(7)8/h9-12,15-18,21-23H,13-14H2,1-8H3 |
| InChIKey | WPGNJDDPTYMRKO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.87 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|