About 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol
3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol (PubChem CID 153333432) has the molecular formula C11H20N2O2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol.
Molecular Properties
| Compound Name | 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol |
| PubChem CID | 153333432 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol |
| SMILES | CCN(C)CCN(C)c1cc(=O)c1=O.CS |
| InChI | InChI=1S/C10H16N2O2.CH4S/c1-4-11(2)5-6-12(3)8-7-9(13)10(8)14;1-2/h7H,4-6H2,1-3H3;2H,1H3 |
| InChIKey | MWRDHQNEGLDJLH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol?
The IUPAC name of 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol (CID 153333432) is 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol.
What is the SMILES notation for 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol?
The canonical SMILES for 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol is CCN(C)CCN(C)c1cc(=O)c1=O.CS.
What is the InChIKey of 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol?
The InChIKey is MWRDHQNEGLDJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2.CH4S/c1-4-11(2)5-6-12(3)8-7-9(13)10(8)14;1-2/h7H,4-6H2,1-3H3;2H,1H3.
What are the key properties of 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol?
3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol has a molecular weight of 244.36 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[ethyl(methyl)amino]ethyl-methylamino]cyclobut-3-ene-1,2-dione;methanethiol is sourced from PubChem (CID 153333432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).