About 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol
5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol (PubChem CID 153333914) has the molecular formula C12H20F2O
and a molecular weight of 218.29 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol.
Molecular Properties
| Compound Name | 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol |
| PubChem CID | 153333914 |
| Molecular Formula | C12H20F2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol |
| SMILES | CC(O)C(F)C(F)C(C)C1=CCCCC1 |
| InChI | InChI=1S/C12H20F2O/c1-8(10-6-4-3-5-7-10)11(13)12(14)9(2)15/h6,8-9,11-12,15H,3-5,7H2,1-2H3 |
| InChIKey | NUTSCEWCXCUHCB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol?
The IUPAC name of 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol (CID 153333914) is 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol.
What is the SMILES notation for 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol?
The canonical SMILES for 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol is CC(O)C(F)C(F)C(C)C1=CCCCC1.
What is the InChIKey of 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol?
The InChIKey is NUTSCEWCXCUHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2O/c1-8(10-6-4-3-5-7-10)11(13)12(14)9(2)15/h6,8-9,11-12,15H,3-5,7H2,1-2H3.
What are the key properties of 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol?
5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol has a molecular weight of 218.29 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexen-1-yl)-3,4-difluorohexan-2-ol is sourced from PubChem (CID 153333914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).