About ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine
ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine (PubChem CID 153334026) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine.
Molecular Properties
| Compound Name | ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine |
| PubChem CID | 153334026 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine |
| SMILES | C=C(C)/C=C\C(=C)NC1COC1.CC |
| InChI | InChI=1S/C10H15NO.C2H6/c1-8(2)4-5-9(3)11-10-6-12-7-10;1-2/h4-5,10-11H,1,3,6-7H2,2H3;1-2H3/b5-4-; |
| InChIKey | RSYDCOWMUUIGJX-MKWAYWHRSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine?
The IUPAC name of ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine (CID 153334026) is ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine.
What is the SMILES notation for ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine?
The canonical SMILES for ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine is C=C(C)/C=C\C(=C)NC1COC1.CC.
What is the InChIKey of ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine?
The InChIKey is RSYDCOWMUUIGJX-MKWAYWHRSA-N. The full InChI is InChI=1S/C10H15NO.C2H6/c1-8(2)4-5-9(3)11-10-6-12-7-10;1-2/h4-5,10-11H,1,3,6-7H2,2H3;1-2H3/b5-4-;.
What are the key properties of ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine?
ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine has a molecular weight of 195.31 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxetan-3-amine is sourced from PubChem (CID 153334026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).