C26H28N2O3S2 — CID 153334060
2-(methylamino)-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid;4-(1,2-thiazolidin-2-yl)benzaldehyde (PubChem CID 153334060) has the molecular formula C26H28N2O3S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 2-(methylamino)-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid;4-(1,2-thiazolidin-2-yl)benzaldehyde.
| Compound Name | 2-(methylamino)-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid;4-(1,2-thiazolidin-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 153334060 |
| Molecular Formula | C26H28N2O3S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-(methylamino)-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid;4-(1,2-thiazolidin-2-yl)benzaldehyde |
| SMILES | CNc1scc(C2CCc3ccccc3C2)c1C(=O)O.O=Cc1ccc(N2CCCS2)cc1 |
| InChI | InChI=1S/C16H17NO2S.C10H11NOS/c1-17-15-14(16(18)19)13(9-20-15)12-7-6-10-4-2-3-5-11(10)8-12;12-8-9-2-4-10(5-3-9)11-6-1-7-13-11/h2-5,9,12,17H,6-8H2,1H3,(H,18,19);2-5,8H,1,6-7H2 |
| InChIKey | PWISAEHVBAKFHT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|