C28H42N2O2 — CID 153334069
N-(cyclohexylmethyl)-4-methylaniline;2-methoxy-4-methyl-N-(oxan-4-ylmethyl)aniline (PubChem CID 153334069) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-methylaniline;2-methoxy-4-methyl-N-(oxan-4-ylmethyl)aniline.
| Compound Name | N-(cyclohexylmethyl)-4-methylaniline;2-methoxy-4-methyl-N-(oxan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 153334069 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | N-(cyclohexylmethyl)-4-methylaniline;2-methoxy-4-methyl-N-(oxan-4-ylmethyl)aniline |
| SMILES | COc1cc(C)ccc1NCC1CCOCC1.Cc1ccc(NCC2CCCCC2)cc1 |
| InChI | InChI=1S/C14H21NO2.C14H21N/c1-11-3-4-13(14(9-11)16-2)15-10-12-5-7-17-8-6-12;1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13/h3-4,9,12,15H,5-8,10H2,1-2H3;7-10,13,15H,2-6,11H2,1H3 |
| InChIKey | ZHHOGISHNRSWIZ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |