C25H26N2O3S2 — CID 153334079
2-[[4-[ethyl(methylsulfanyl)amino]benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid (PubChem CID 153334079) has the molecular formula C25H26N2O3S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-[[4-[ethyl(methylsulfanyl)amino]benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-[[4-[ethyl(methylsulfanyl)amino]benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 153334079 |
| Molecular Formula | C25H26N2O3S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[[4-[ethyl(methylsulfanyl)amino]benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid |
| SMILES | CCN(SC)c1ccc(C(=O)Nc2scc(C3CCc4ccccc4C3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C25H26N2O3S2/c1-3-27(31-2)20-12-10-17(11-13-20)23(28)26-24-22(25(29)30)21(15-32-24)19-9-8-16-6-4-5-7-18(16)14-19/h4-7,10-13,15,19H,3,8-9,14H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | CGMOBAGDPFBLEK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|