C21H26N6 — CID 153334180
3-[4-(2,6-diazaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-2-methanimidoyl-4-methylaniline (PubChem CID 153334180) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is 3-[4-(2,6-diazaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-2-methanimidoyl-4-methylaniline.
| Compound Name | 3-[4-(2,6-diazaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-2-methanimidoyl-4-methylaniline |
|---|---|
| PubChem CID | 153334180 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-[4-(2,6-diazaspiro[3.3]heptan-2-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]-2-methanimidoyl-4-methylaniline |
| SMILES | [H]/N=C/c1c(N)ccc(C)c1C1CCc2c(ncnc2N2CC3(CNC3)C2)C1 |
| InChI | InChI=1S/C21H26N6/c1-13-2-5-17(23)16(7-22)19(13)14-3-4-15-18(6-14)25-12-26-20(15)27-10-21(11-27)8-24-9-21/h2,5,7,12,14,22,24H,3-4,6,8-11,23H2,1H3/b22-7+ |
| InChIKey | MXVVGAJSLFXPAD-QPJQQBGISA-N |
| XLogP | 2.05 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|