C24H31ClIN8P — CID 153334219
1-[7-(5-chloro-1-iodophosphanylindazol-4-yl)-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-2-yl]-N,N-dimethylazetidin-3-amine (PubChem CID 153334219) has the molecular formula C24H31ClIN8P and a molecular weight of 624.90 g/mol. Its IUPAC name is 1-[7-(5-chloro-1-iodophosphanylindazol-4-yl)-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-2-yl]-N,N-dimethylazetidin-3-amine.
| Compound Name | 1-[7-(5-chloro-1-iodophosphanylindazol-4-yl)-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-2-yl]-N,N-dimethylazetidin-3-amine |
|---|---|
| PubChem CID | 153334219 |
| Molecular Formula | C24H31ClIN8P |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | 1-[7-(5-chloro-1-iodophosphanylindazol-4-yl)-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-2-yl]-N,N-dimethylazetidin-3-amine |
| SMILES | CN(C)C1CN(c2nc3c(c(N4CCNCC4)n2)CCC(c2c(Cl)ccc4c2cnn4PI)C3)C1 |
| InChI | InChI=1S/C24H31ClIN8P/c1-31(2)16-13-33(14-16)24-29-20-11-15(3-4-17(20)23(30-24)32-9-7-27-8-10-32)22-18-12-28-34(35-26)21(18)6-5-19(22)25/h5-6,12,15-16,27,35H,3-4,7-11,13-14H2,1-2H3 |
| InChIKey | ZUCJHXSMFASDHE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|