C23H37ClN6 — CID 153334298
5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-amine;N-pentylcyclohexanamine (PubChem CID 153334298) has the molecular formula C23H37ClN6 and a molecular weight of 433.04 g/mol. Its IUPAC name is 5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-amine;N-pentylcyclohexanamine.
| Compound Name | 5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-amine;N-pentylcyclohexanamine |
|---|---|
| PubChem CID | 153334298 |
| Molecular Formula | C23H37ClN6 |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]pyrimidin-2-amine;N-pentylcyclohexanamine |
| SMILES | CCCCCNC1CCCCC1.Cn1ncc(-c2nc(N)ncc2Cl)c1CC1CC1 |
| InChI | InChI=1S/C12H14ClN5.C11H23N/c1-18-10(4-7-2-3-7)8(5-16-18)11-9(13)6-15-12(14)17-11;1-2-3-7-10-12-11-8-5-4-6-9-11/h5-7H,2-4H2,1H3,(H2,14,15,17);11-12H,2-10H2,1H3 |
| InChIKey | YBBNEOULFRZWSP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|