C24H29N5O2S — CID 153334720
N-[4-[4-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)piperidin-1-yl]sulfanylphenyl]-4-aminobutanamide (PubChem CID 153334720) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is N-[4-[4-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)piperidin-1-yl]sulfanylphenyl]-4-aminobutanamide.
| Compound Name | N-[4-[4-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)piperidin-1-yl]sulfanylphenyl]-4-aminobutanamide |
|---|---|
| PubChem CID | 153334720 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[4-[4-(3-acetylpyrazolo[1,5-a]pyridin-5-yl)piperidin-1-yl]sulfanylphenyl]-4-aminobutanamide |
| SMILES | CC(=O)c1cnn2ccc(C3CCN(Sc4ccc(NC(=O)CCCN)cc4)CC3)cc12 |
| InChI | InChI=1S/C24H29N5O2S/c1-17(30)22-16-26-29-14-10-19(15-23(22)29)18-8-12-28(13-9-18)32-21-6-4-20(5-7-21)27-24(31)3-2-11-25/h4-7,10,14-16,18H,2-3,8-9,11-13,25H2,1H3,(H,27,31) |
| InChIKey | BEQCYHMXWNDOBZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|