C33H54BN3O7 — CID 153335167
benzyl 4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1-carboxylate (PubChem CID 153335167) has the molecular formula C33H54BN3O7 and a molecular weight of 615.62 g/mol. Its IUPAC name is benzyl 4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 153335167 |
| Molecular Formula | C33H54BN3O7 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.41 |
| IUPAC Name | benzyl 4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N(C)C1CC(CCCCB2OC(C)(C)C(C)(C)O2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C33H54BN3O7/c1-23(2)27(35-29(39)42-31(3,4)5)28(38)36(10)26-20-25(18-14-15-19-34-43-32(6,7)33(8,9)44-34)37(21-26)30(40)41-22-24-16-12-11-13-17-24/h11-13,16-17,23,25-27H,14-15,18-22H2,1-10H3,(H,35,39) |
| InChIKey | QVDPIHDYTDOESX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|