About CID 153335451
CID 153335451 (PubChem CID 153335451) has the molecular formula C40H47B2N7O3S
and a molecular weight of 727.55 g/mol.
Molecular Properties
| Compound Name | CID 153335451 |
| PubChem CID | 153335451 |
| Molecular Formula | C40H47B2N7O3S |
| Molecular Weight | 727.55 g/mol |
| Exact Mass | 727.36 |
| IUPAC Name | — |
| SMILES | [B]C([B])(COC1C=CN(c2ccc3c(n2)N2CC(CC2(C)C)C(C)CCNc2nc(ccc2OCc2ccccc2)SNC3=O)N1)C1C2(CC2)C12CC2 |
| InChI | InChI=1S/C40H47B2N7O3S/c1-25-13-19-43-33-29(51-23-26-7-5-4-6-8-26)10-12-32(45-33)53-47-35(50)28-9-11-30(44-34(28)48-22-27(25)21-37(48,2)3)49-20-14-31(46-49)52-24-40(41,42)36-38(15-16-38)39(36)17-18-39/h4-12,14,20,25,27,31,36,46H,13,15-19,21-24H2,1-3H3,(H,43,45)(H,47,50) |
| InChIKey | QJEQRHKMHMXNCX-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 727.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 153335451 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153335451?
The IUPAC name of CID 153335451 (CID 153335451) is not available.
What is the SMILES notation for CID 153335451?
The canonical SMILES for CID 153335451 is [B]C([B])(COC1C=CN(c2ccc3c(n2)N2CC(CC2(C)C)C(C)CCNc2nc(ccc2OCc2ccccc2)SNC3=O)N1)C1C2(CC2)C12CC2.
What is the InChIKey of CID 153335451?
The InChIKey is QJEQRHKMHMXNCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H47B2N7O3S/c1-25-13-19-43-33-29(51-23-26-7-5-4-6-8-26)10-12-32(45-33)53-47-35(50)28-9-11-30(44-34(28)48-22-27(25)21-37(48,2)3)49-20-14-31(46-49)52-24-40(41,42)36-38(15-16-38)39(36)17-18-39/h4-12,14,20,25,27,31,36,46H,13,15-19,21-24H2,1-3H3,(H,43,45)(H,47,50).
What are the key properties of CID 153335451?
CID 153335451 has a molecular weight of 727.55 g/mol, XLogP of 6.37, 8 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153335451 is sourced from PubChem (CID 153335451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).