C20H18ClF4N5O2S — CID 153335620
[[2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carbonyl]amino] (1E)-N-(1-fluoroethenyl)prop-2-enimidothioate (PubChem CID 153335620) has the molecular formula C20H18ClF4N5O2S and a molecular weight of 503.91 g/mol. Its IUPAC name is [[2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carbonyl]amino] (1E)-N-(1-fluoroethenyl)prop-2-enimidothioate.
| Compound Name | [[2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carbonyl]amino] (1E)-N-(1-fluoroethenyl)prop-2-enimidothioate |
|---|---|
| PubChem CID | 153335620 |
| Molecular Formula | C20H18ClF4N5O2S |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | [[2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carbonyl]amino] (1E)-N-(1-fluoroethenyl)prop-2-enimidothioate |
| SMILES | C=C/C(=N\C(=C)F)SNC(=O)c1ccc(-n2ccc(OCCC3(C(F)(F)F)CC3)n2)nc1Cl |
| InChI | InChI=1S/C20H18ClF4N5O2S/c1-3-16(26-12(2)22)33-29-18(31)13-4-5-14(27-17(13)21)30-10-6-15(28-30)32-11-9-19(7-8-19)20(23,24)25/h3-6,10H,1-2,7-9,11H2,(H,29,31)/b26-16+ |
| InChIKey | LDQBZKFNTMPBPG-WGOQTCKBSA-N |
| XLogP | 5.44 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|